CAS 927996-01-8 appears in our catalog under these names: 3-(1,1-Dioxido-1,2-thiazinan-2-yl)-4-methylbenzoic acid, 95%, 3-(1,1-DIoxido-1,2-thiazinan-2-yl)-4-methylbenzoic acid, 98%, 3-(1,1-Dioxido-1,2-thiazinan-2-yl)-4-methylbenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 10g.
3-(1,1-dioxothiazinan-2-yl)-4-methylbenzoic acid (CAS 927996-01-8) is a chemical compound with the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. IUPAC name: 3-(1,1-dioxothiazinan-2-yl)-4-methylbenzoic acid. InChIKey: OFTMDBCGSDTPER-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4S |
|---|---|
| Molecular weight | 269.32 g/mol |
| IUPAC name | 3-(1,1-dioxothiazinan-2-yl)-4-methylbenzoic acid |
| InChIKey | OFTMDBCGSDTPER-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)N2CCCCS2(=O)=O |
Computed by PubChem (NCBI)