CAS 927996-69-8 is the registry number for 2-(1H-1,3-Benzodiazol-1-yl)-1-(4-fluorophenyl)ethan-1-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethanamine (CAS 927996-69-8) is a chemical compound with the molecular formula C15H14FN3 and a molecular weight of 255.29 g/mol. IUPAC name: 2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethanamine. InChIKey: HTDKHVUZOKNNEP-UHFFFAOYSA-N.
| Molecular formula | C15H14FN3 |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethanamine |
| InChIKey | HTDKHVUZOKNNEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2CC(C3=CC=C(C=C3)F)N |
Computed by PubChem (NCBI)