CAS 928048-91-3 is the registry number for Methyl (S)-2-(1H-imidazol-1-yl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-imidazol-1-ylpropanoate (CAS 928048-91-3) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: methyl (2S)-2-imidazol-1-ylpropanoate. InChIKey: HSUZCYNWDKTPDZ-LURJTMIESA-N.
| Molecular formula | C7H10N2O2 |
|---|---|
| Molecular weight | 154.17 g/mol |
| IUPAC name | methyl (2S)-2-imidazol-1-ylpropanoate |
| InChIKey | HSUZCYNWDKTPDZ-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)OC)N1C=CN=C1 |
Computed by PubChem (NCBI)