Products 92829-71-5
CAS 92829-71-5 is the registry number for Magnotriol B. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-hydroxy-3-prop-2-enylphenyl)benzene-1,4-diol (CAS 92829-71-5) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(4-hydroxy-3-prop-2-enylphenyl)benzene-1,4-diol. InChIKey: KNQRYSAELBJEAD-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-(4-hydroxy-3-prop-2-enylphenyl)benzene-1,4-diol |
| InChIKey | KNQRYSAELBJEAD-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)O)O)O |
Computed by PubChem (NCBI)