CAS 928330-94-3 is the registry number for (2S,3R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-3-methylpyrrolidine-2-carboxylic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-methylpyrrolidine-2-carboxylic acid (CAS 928330-94-3) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-methylpyrrolidine-2-carboxylic acid. InChIKey: YLOIPWYYPLYLFH-YJYMSZOUSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-methylpyrrolidine-2-carboxylic acid |
| InChIKey | YLOIPWYYPLYLFH-YJYMSZOUSA-N |
| SMILES | C[C@@H]1CCN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)