CAS 928615-46-7 appears in our catalog under these names: Vonoprazan Impurity 4, TAK438 Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-[5-(2-fluorophenyl)-1-pyridin-2-ylsulfonylpyrrol-3-yl]-N-methylmethanamine (CAS 928615-46-7) is a chemical compound with the molecular formula C17H16FN3O2S and a molecular weight of 345.4 g/mol. IUPAC name: 1-[5-(2-fluorophenyl)-1-pyridin-2-ylsulfonylpyrrol-3-yl]-N-methylmethanamine. InChIKey: JGSLLIOGLMIDOK-UHFFFAOYSA-N.
| Molecular formula | C17H16FN3O2S |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 1-[5-(2-fluorophenyl)-1-pyridin-2-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
| InChIKey | JGSLLIOGLMIDOK-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)