Products 1172940-17-8
CAS 1172940-17-8 is the registry number for 1-(4-(4-Fluorophenyl)-2-thiazolyl)-3,5-dimethyl-1H-pyrazole-4-propanoic Acid. Offered by: TRC. Available pack sizes: 100mg.
3-[1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3,5-dimethylpyrazol-4-yl]propanoic acid (CAS 1172940-17-8) is a chemical compound with the molecular formula C17H16FN3O2S and a molecular weight of 345.4 g/mol. IUPAC name: 3-[1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3,5-dimethylpyrazol-4-yl]propanoic acid. InChIKey: VTNODBWETVLFIK-UHFFFAOYSA-N.
| Molecular formula | C17H16FN3O2S |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 3-[1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3,5-dimethylpyrazol-4-yl]propanoic acid |
| InChIKey | VTNODBWETVLFIK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=NC(=CS2)C3=CC=C(C=C3)F)C)CCC(=O)O |
Computed by PubChem (NCBI)