CAS 881733-36-4 appears in our catalog under these names: Vonoprazan Impurity 2, Vonoprazan Impurity 5 discontinued see RM-V141650, 1-(5-(4-Fluorophenyl)-1-(pyridin-3-ylsulfonyl)-1H-pyrrol-3-yl)-N-methylmethanamine, 1-(5-(4-Fluorophenyl)-1-(pyridin-3-ylsulfonyl)-1H-pyrrol-3-yl)-N-methylmethanamine 97%, TAK438 Impurity 5. Offered by: Chemat Brand, Biosynth, Ambeed, Hubei YoungXin. Available pack sizes: on request, 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 1g.
1-[5-(4-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine (CAS 881733-36-4) is a chemical compound with the molecular formula C17H16FN3O2S and a molecular weight of 345.4 g/mol. IUPAC name: 1-[5-(4-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine. InChIKey: JMURFSLDHOKJCN-UHFFFAOYSA-N.
| Molecular formula | C17H16FN3O2S |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 1-[5-(4-fluorophenyl)-1-pyridin-3-ylsulfonylpyrrol-3-yl]-N-methylmethanamine |
| InChIKey | JMURFSLDHOKJCN-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(C(=C1)C2=CC=C(C=C2)F)S(=O)(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)