CAS 928797-50-6 appears in our catalog under these names: Gemcitabine Impurity 11, Gemcitabine Impurity 18. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanoate (CAS 928797-50-6) is a chemical compound with the molecular formula C10H16F2O5 and a molecular weight of 254.23 g/mol. IUPAC name: ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanoate. InChIKey: OUFRYOWGFSOSEY-ULUSZKPHSA-N.
| Molecular formula | C10H16F2O5 |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanoate |
| InChIKey | OUFRYOWGFSOSEY-ULUSZKPHSA-N |
| SMILES | CCOC(=O)C(C([C@H]1COC(O1)(C)C)O)(F)F |
Computed by PubChem (NCBI)