CAS 95058-93-8 is the registry number for 2-Deoxy-2,2-difluoro-4,5-O-isopropylidene-D-threo-pentonic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Ethyl (3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanoate (CAS 95058-93-8) is a chemical compound with the molecular formula C10H16F2O5 and a molecular weight of 254.23 g/mol. IUPAC name: ethyl (3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanoate. InChIKey: OUFRYOWGFSOSEY-RQJHMYQMSA-N.
| Molecular formula | C10H16F2O5 |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | ethyl (3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluoro-3-hydroxypropanoate |
| InChIKey | OUFRYOWGFSOSEY-RQJHMYQMSA-N |
| SMILES | CCOC(=O)C([C@H]([C@H]1COC(O1)(C)C)O)(F)F |
Computed by PubChem (NCBI)