CAS 92886-99-2 is the registry number for N-(2,6-Dimethylphenyl)-3-hydroxynaphthalene-2-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-(2,6-dimethylphenyl)-3-hydroxynaphthalene-2-carboxamide (CAS 92886-99-2) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-3-hydroxynaphthalene-2-carboxamide. InChIKey: CEMCCSHSPXMHDC-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-3-hydroxynaphthalene-2-carboxamide |
| InChIKey | CEMCCSHSPXMHDC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2=CC3=CC=CC=C3C=C2O |
Computed by PubChem (NCBI)