Products 92944-37-1
CAS 92944-37-1 is the registry number for 2-Bromo-N-(3-tert-butyl-1,2-oxazol-5-yl)acetamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-N-(3-tert-butyl-1,2-oxazol-5-yl)acetamide (CAS 92944-37-1) is a chemical compound with the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. IUPAC name: 2-bromo-N-(3-tert-butyl-1,2-oxazol-5-yl)acetamide. InChIKey: KTQOPAUOBHJHTQ-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2O2 |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | 2-bromo-N-(3-tert-butyl-1,2-oxazol-5-yl)acetamide |
| InChIKey | KTQOPAUOBHJHTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NOC(=C1)NC(=O)CBr |
Computed by PubChem (NCBI)