CAS 929975-21-3 appears in our catalog under these names: 1-(4-Fluorophenyl)-5-thien-2-yl-1h-1,2,4-triazole-3-carboxylic acid, 95%, 1-(4-Fluorophenyl)-5-(thiophen-2-yl)-1H-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
1-(4-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid (CAS 929975-21-3) is a chemical compound with the molecular formula C13H8FN3O2S and a molecular weight of 289.29 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid. InChIKey: YHEVWNCDSGPELI-UHFFFAOYSA-N.
| Molecular formula | C13H8FN3O2S |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | YHEVWNCDSGPELI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC(=NN2C3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)