CAS 929975-46-2 is the registry number for 1-(3-Fluorophenyl)-5-(thiophen-2-yl)-1H-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid (CAS 929975-46-2) is a chemical compound with the molecular formula C13H8FN3O2S and a molecular weight of 289.29 g/mol. IUPAC name: 1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid. InChIKey: UPTSZBPQZBXFOY-UHFFFAOYSA-N.
| Molecular formula | C13H8FN3O2S |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-5-thiophen-2-yl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | UPTSZBPQZBXFOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C(=NC(=N2)C(=O)O)C3=CC=CS3 |
Computed by PubChem (NCBI)