CAS 930396-00-2 appears in our catalog under these names: tert-Butyl 3-oxo-4-phenylpiperidine-1-carboxylate, 95+%, tert–Butyl 3–oxo–4–phenylpiperidine–1–carboxylate, tert-Butyl 3-oxo-4-phenylpiperidine-1-carboxylate. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 3-oxo-4-phenylpiperidine-1-carboxylate (CAS 930396-00-2) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: tert-butyl 3-oxo-4-phenylpiperidine-1-carboxylate. InChIKey: MBZIXYGSCLOCQG-UHFFFAOYSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | tert-butyl 3-oxo-4-phenylpiperidine-1-carboxylate |
| InChIKey | MBZIXYGSCLOCQG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)