Products 930599-58-9
CAS 930599-58-9 is the registry number for 5-Iodo-2-methylbenzotrifluoride, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
4-iodo-1-methyl-2-(trifluoromethyl)benzene (CAS 930599-58-9) is a chemical compound with the molecular formula C8H6F3I and a molecular weight of 286.03 g/mol. IUPAC name: 4-iodo-1-methyl-2-(trifluoromethyl)benzene. InChIKey: IRNKYHBUZZWJGM-UHFFFAOYSA-N.
| Molecular formula | C8H6F3I |
|---|---|
| Molecular weight | 286.03 g/mol |
| IUPAC name | 4-iodo-1-methyl-2-(trifluoromethyl)benzene |
| InChIKey | IRNKYHBUZZWJGM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)C(F)(F)F |
Computed by PubChem (NCBI)