Products 931114-98-6
CAS 931114-98-6 appears in our catalog under these names: (S，E)–Deca–2，9–diene–4，6–diyne–1，8–diol, (S,E)-Deca-2,9-diene-4,6-diyne-1,8-diol. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
(2E,8S)-deca-2,9-dien-4,6-diyne-1,8-diol (CAS 931114-98-6) is a chemical compound with the molecular formula C10H10O2 and a molecular weight of 162.18 g/mol. IUPAC name: (2E,8S)-deca-2,9-dien-4,6-diyne-1,8-diol. InChIKey: BAULTANCNGCCJT-STUBTGCMSA-N.
| Molecular formula | C10H10O2 |
|---|---|
| Molecular weight | 162.18 g/mol |
| IUPAC name | (2E,8S)-deca-2,9-dien-4,6-diyne-1,8-diol |
| InChIKey | BAULTANCNGCCJT-STUBTGCMSA-N |
| SMILES | C=C[C@@H](C#CC#C/C=C/CO)O |
Computed by PubChem (NCBI)