CAS 93140-75-1 appears in our catalog under these names: 2-(3-Aminophenoxy)benzamide, 2-(3-Aminophenoxy)benzamide, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 2,5g, 1g, 50mg, 0,5g.
2-(3-aminophenoxy)benzamide (CAS 93140-75-1) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 2-(3-aminophenoxy)benzamide. InChIKey: XLSPVAFOIRLXNJ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 2-(3-aminophenoxy)benzamide |
| InChIKey | XLSPVAFOIRLXNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N)OC2=CC=CC(=C2)N |
Computed by PubChem (NCBI)