Products 931596-95-1
CAS 931596-95-1 appears in our catalog under these names: P3FI-63/ 99.16% (existing batch purity), P3FI–63, P3FI-63, 98.35%, N'-(3,5-DIMETHYLBENZOYL)PYRIDINE-2-CARBOHYDRAZIDE. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL, 10 mg.
N'-(3,5-dimethylbenzoyl)pyridine-2-carbohydrazide (CAS 931596-95-1) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: N'-(3,5-dimethylbenzoyl)pyridine-2-carbohydrazide. InChIKey: YBHBUAJHPVSQNM-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | N'-(3,5-dimethylbenzoyl)pyridine-2-carbohydrazide |
| InChIKey | YBHBUAJHPVSQNM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)NNC(=O)C2=CC=CC=N2)C |
Computed by PubChem (NCBI)