CAS 93189-07-2 is the registry number for 3-(Anilinomethyl)phenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(anilinomethyl)phenol (CAS 93189-07-2) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 3-(anilinomethyl)phenol. InChIKey: ZPLBVHYGJXHULA-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-(anilinomethyl)phenol |
| InChIKey | ZPLBVHYGJXHULA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NCC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)