CAS 931991-22-9 appears in our catalog under these names: ((2,4-Dichlorophenyl)methyl)(2-methylbutan-2-yl)amine, 95%, ((2,4-Dichlorophenyl)methyl)(2-methylbutan-2-yl)amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
N-[(2,4-dichlorophenyl)methyl]-2-methylbutan-2-amine (CAS 931991-22-9) is a chemical compound with the molecular formula C12H17Cl2N and a molecular weight of 246.17 g/mol. IUPAC name: N-[(2,4-dichlorophenyl)methyl]-2-methylbutan-2-amine. InChIKey: OFLCYJYBXSEIIF-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | N-[(2,4-dichlorophenyl)methyl]-2-methylbutan-2-amine |
| InChIKey | OFLCYJYBXSEIIF-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NCC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)