CAS 93201-85-5 is the registry number for 2-Methyl-3H-imidazo(4,5-F)quinoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-3H-imidazo[4,5-f]quinoline (CAS 93201-85-5) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. IUPAC name: 2-methyl-3H-imidazo[4,5-f]quinoline. InChIKey: IUQHRMZIDYAPEW-UHFFFAOYSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 2-methyl-3H-imidazo[4,5-f]quinoline |
| InChIKey | IUQHRMZIDYAPEW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=CC3=C2C=CC=N3 |
Computed by PubChem (NCBI)