CAS 932464-81-8 is the registry number for Methyl 3-(N-(3,5-dimethylphenyl)sulfamoyl)-4-fluorobenzo[b]thiophene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-[(3,5-dimethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate (CAS 932464-81-8) is a chemical compound with the molecular formula C18H16FNO4S2 and a molecular weight of 393.5 g/mol. IUPAC name: methyl 3-[(3,5-dimethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate. InChIKey: WBKVAALYDPTBAD-UHFFFAOYSA-N.
| Molecular formula | C18H16FNO4S2 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | methyl 3-[(3,5-dimethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | WBKVAALYDPTBAD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NS(=O)(=O)C2=C(SC3=CC=CC(=C32)F)C(=O)OC)C |
Computed by PubChem (NCBI)