CAS 932520-41-7 is the registry number for Methyl 3-(N-(2,4-dimethylphenyl)sulfamoyl)-4-fluorobenzo[b]thiophene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-[(2,4-dimethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate (CAS 932520-41-7) is a chemical compound with the molecular formula C18H16FNO4S2 and a molecular weight of 393.5 g/mol. IUPAC name: methyl 3-[(2,4-dimethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate. InChIKey: WUIPFWVRBJTITA-UHFFFAOYSA-N.
| Molecular formula | C18H16FNO4S2 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | methyl 3-[(2,4-dimethylphenyl)sulfamoyl]-4-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | WUIPFWVRBJTITA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C2=C(SC3=CC=CC(=C32)F)C(=O)OC)C |
Computed by PubChem (NCBI)