Products 932831-76-0
CAS 932831-76-0 is the registry number for 1-(5-(Ttert-butyl)-2-ethoxyphenyl)ethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(5-tert-butyl-2-ethoxyphenyl)ethanone (CAS 932831-76-0) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 1-(5-tert-butyl-2-ethoxyphenyl)ethanone. InChIKey: KMOWGTHYIGHSRI-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 1-(5-tert-butyl-2-ethoxyphenyl)ethanone |
| InChIKey | KMOWGTHYIGHSRI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(C)(C)C)C(=O)C |
Computed by PubChem (NCBI)