CAS 933687-77-5 appears in our catalog under these names: 2-(3-(Trifluoromethyl)benzyl)pyrrolidine, 95%, 2-{(3-(Trifluoromethyl)phenyl)methyl}pyrrolidine. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine (CAS 933687-77-5) is a chemical compound with the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. IUPAC name: 2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine. InChIKey: OUAAXGWXYJOVSN-UHFFFAOYSA-N.
| Molecular formula | C12H14F3N |
|---|---|
| Molecular weight | 229.24 g/mol |
| IUPAC name | 2-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine |
| InChIKey | OUAAXGWXYJOVSN-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)CC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)