Products 933731-98-7

CAS 933731-98-7 is the registry number for 2-(2-(Thiophen-2-yl)ethoxy)acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(2-thiophen-2-ylethoxy)acetic acid (CAS 933731-98-7) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. IUPAC name: 2-(2-thiophen-2-ylethoxy)acetic acid. InChIKey: NWMNVNKDUBNPKQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O3S
Molecular weight186.23 g/mol
IUPAC name2-(2-thiophen-2-ylethoxy)acetic acid
InChIKeyNWMNVNKDUBNPKQ-UHFFFAOYSA-N
SMILESC1=CSC(=C1)CCOCC(=O)O

Computed by PubChem (NCBI)