Products 933734-89-5

CAS 933734-89-5 is the registry number for 3-Pyridazineacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-pyridazin-3-ylacetic acid (CAS 933734-89-5) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 138.12 g/mol. IUPAC name: 2-pyridazin-3-ylacetic acid. InChIKey: RWHJUYXIHVKMDK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O2
Molecular weight138.12 g/mol
IUPAC name2-pyridazin-3-ylacetic acid
InChIKeyRWHJUYXIHVKMDK-UHFFFAOYSA-N
SMILESC1=CC(=NN=C1)CC(=O)O

Computed by PubChem (NCBI)