Products 933745-98-3

CAS 933745-98-3 appears in our catalog under these names: 5,6-Dimethyl-4-pyrimidinecarboxylic acid, 95%, 5,6–Dimethylpyrimidine–4–carboxylic acid, 5,6-dimethylpyrimidine-4-carboxylic acid. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

5,6-dimethylpyrimidine-4-carboxylic acid (CAS 933745-98-3) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 5,6-dimethylpyrimidine-4-carboxylic acid. InChIKey: PXOZIDJACWTSFP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O2
Molecular weight152.15 g/mol
IUPAC name5,6-dimethylpyrimidine-4-carboxylic acid
InChIKeyPXOZIDJACWTSFP-UHFFFAOYSA-N
SMILESCC1=C(N=CN=C1C(=O)O)C

Computed by PubChem (NCBI)