CAS 933753-63-0 is the registry number for 2-Oxoindoline-7-carbaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-oxo-1,3-dihydroindole-7-carbaldehyde (CAS 933753-63-0) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 2-oxo-1,3-dihydroindole-7-carbaldehyde. InChIKey: WBNYFGSNZDSVEB-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroindole-7-carbaldehyde |
| InChIKey | WBNYFGSNZDSVEB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C=O)NC1=O |
Computed by PubChem (NCBI)