Products 934397-71-4
CAS 934397-71-4 appears in our catalog under these names: 3,5-Difluorobenzoic-d3 Acid, 98 atom % D, min 98% Chemical Purity, 3,5-Difluorobenzoic acid-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
2,4,6-trideuterio-3,5-difluorobenzoic acid (CAS 934397-71-4) is a chemical compound with the molecular formula C7H4F2O2 and a molecular weight of 161.12 g/mol. IUPAC name: 2,4,6-trideuterio-3,5-difluorobenzoic acid. InChIKey: GONAVIHGXFBTOZ-CBYSEHNBSA-N.
| Molecular formula | C7H4F2O2 |
|---|---|
| Molecular weight | 161.12 g/mol |
| IUPAC name | 2,4,6-trideuterio-3,5-difluorobenzoic acid |
| InChIKey | GONAVIHGXFBTOZ-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1F)[2H])F)[2H])C(=O)O |
Computed by PubChem (NCBI)