CAS 936-87-8 appears in our catalog under these names: Cis-Caronic Acid, rel–(1R,2S)–3,3–Dimethylcyclopropane–1,2–dicarboxylic acid, (1R,2S)-3,3-Dimethylcyclopropane-1,2-dicarboxylic acid. Offered by: Chemat Brand, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1g, 250mg, 2,5g.
Cis-(1S,2R)-3,3-dimethylcyclopropane-1,2-dicarboxylic acid (CAS 936-87-8) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1S,2R)-3,3-dimethylcyclopropane-1,2-dicarboxylic acid. InChIKey: MSPJNHHBNOLHOC-ZXZARUISSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1S,2R)-3,3-dimethylcyclopropane-1,2-dicarboxylic acid |
| InChIKey | MSPJNHHBNOLHOC-ZXZARUISSA-N |
| SMILES | CC1([C@H]([C@H]1C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)