Products 936129-68-9
CAS 936129-68-9 is the registry number for 1-tert-Butyl-5-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-tert-butyl-5-phenylpyrazole-4-carboxylic acid (CAS 936129-68-9) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 1-tert-butyl-5-phenylpyrazole-4-carboxylic acid. InChIKey: SIRDLRVZQORBGV-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-tert-butyl-5-phenylpyrazole-4-carboxylic acid |
| InChIKey | SIRDLRVZQORBGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=C(C=N1)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)