Products 93618-32-7
CAS 93618-32-7 appears in our catalog under these names: 3-(3-Chlorophenyl)-1-methyl-1h-pyrazole-5-carboxylic acid, 95%, 3-(3-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic Acid, 3-(3-Chlorophenyl)-1-methyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g, 500mg.
3-(3-chlorophenyl)-1-methylpyrazole-5-carboxylic acid (CAS 93618-32-7) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: 3-(3-chlorophenyl)-1-methylpyrazole-5-carboxylic acid. InChIKey: FNZUGHJDLQTKKA-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1-methylpyrazole-5-carboxylic acid |
| InChIKey | FNZUGHJDLQTKKA-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)