Products 93664-13-2

CAS 93664-13-2 is the registry number for 3-(1-Phenyl-ethylsulfanyl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(1-phenylethylsulfanyl)propanoic acid (CAS 93664-13-2) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 3-(1-phenylethylsulfanyl)propanoic acid. InChIKey: JQLUVXNTOOVWER-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O2S
Molecular weight210.29 g/mol
IUPAC name3-(1-phenylethylsulfanyl)propanoic acid
InChIKeyJQLUVXNTOOVWER-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)SCCC(=O)O

Computed by PubChem (NCBI)