Products 93673-81-5

CAS 93673-81-5 appears in our catalog under these names: Magnolignan A, Magnolignan A, ≥98%, ≥98%. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, 5mg, 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

(2R)-3-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]propane-1,2-diol (CAS 93673-81-5) is a chemical compound with the molecular formula C18H20O4 and a molecular weight of 300.3 g/mol. IUPAC name: (2R)-3-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]propane-1,2-diol. InChIKey: ORPULAPYNPMMAQ-CQSZACIVSA-N.

Identity
Molecular formulaC18H20O4
Molecular weight300.3 g/mol
IUPAC name(2R)-3-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]propane-1,2-diol
InChIKeyORPULAPYNPMMAQ-CQSZACIVSA-N
SMILESC=CCC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)C[C@H](CO)O)O

Computed by PubChem (NCBI)