CAS 936850-12-3 appears in our catalog under these names: tert-Butyl 3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate, 98%, 98%, tert-Butyl 3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate (CAS 936850-12-3) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate. InChIKey: OROYAGCOSGRUQJ-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 3,3-dimethyl-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate |
| InChIKey | OROYAGCOSGRUQJ-UHFFFAOYSA-N |
| SMILES | CC1(COC12CN(C2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)