Products 93697-42-8
CAS 93697-42-8 appears in our catalog under these names: Magnolignan C, Magnolignan C, ≥98%, ≥98%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
3-[4-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)phenyl]propane-1,2-diol (CAS 93697-42-8) is a chemical compound with the molecular formula C18H20O4 and a molecular weight of 300.3 g/mol. IUPAC name: 3-[4-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)phenyl]propane-1,2-diol. InChIKey: LHJCLTLPXXKFTJ-UHFFFAOYSA-N.
| Molecular formula | C18H20O4 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | 3-[4-hydroxy-3-(4-hydroxy-3-prop-2-enylphenyl)phenyl]propane-1,2-diol |
| InChIKey | LHJCLTLPXXKFTJ-UHFFFAOYSA-N |
| SMILES | C=CCC1=C(C=CC(=C1)C2=C(C=CC(=C2)CC(CO)O)O)O |
Computed by PubChem (NCBI)