CAS 937047-43-3 is the registry number for Rel-(4aR,8aR)-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,8aR)-4a,5,6,7,8,8a-hexahydro-4H-pyrido[4,3-b][1,4]oxazin-3-one (CAS 937047-43-3) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: (4aR,8aR)-4a,5,6,7,8,8a-hexahydro-4H-pyrido[4,3-b][1,4]oxazin-3-one. InChIKey: CPDAYCDBCSPKNF-PHDIDXHHSA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (4aR,8aR)-4a,5,6,7,8,8a-hexahydro-4H-pyrido[4,3-b][1,4]oxazin-3-one |
| InChIKey | CPDAYCDBCSPKNF-PHDIDXHHSA-N |
| SMILES | C1CNC[C@@H]2[C@@H]1OCC(=O)N2 |
Computed by PubChem (NCBI)