CAS 93748-14-2 appears in our catalog under these names: 2-(4-tert-Butylphenyl)-2-methylpropanoic acid, 2-(4-tert-Butylphenyl)-2-methylpropanoic acid, 95%, 2–(4–(tert–butyl)phenyl)–2–methylpropanoic acid, 2-(4-(tert-Butyl)phenyl)-2-methylpropanoic acid, 2-(4-(tert-Butyl)phenyl)-2-methylpropanoic acid, 95%. Offered by: Biosynth, Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 1g, 250mg, 50mg.
2-(4-tert-butylphenyl)-2-methylpropanoic acid (CAS 93748-14-2) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-2-methylpropanoic acid. InChIKey: OHAKGGAAZZPXLJ-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-2-methylpropanoic acid |
| InChIKey | OHAKGGAAZZPXLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)