Products 93748-20-0
CAS 93748-20-0 appears in our catalog under these names: 2-(3-Fluorophenyl)-2-methylpropanoic acid, 98%, 2-(3-Fluorophenyl)-2-methylpropanoic acid, 2-(3-Fluorophenyl)-2-methylpropanoic acid 98%, 2-(3-Fluorophenyl)-2-methylpropanoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 10g, 1g, 2,5g, 100mg.
2-(3-fluorophenyl)-2-methylpropanoic acid (CAS 93748-20-0) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 2-(3-fluorophenyl)-2-methylpropanoic acid. InChIKey: SVKJEUSESWZLJH-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | SVKJEUSESWZLJH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)F)C(=O)O |
Computed by PubChem (NCBI)