Products 93753-33-4
CAS 93753-33-4 appears in our catalog under these names: Magnolignan D, Magnaldehyde D. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)benzaldehyde (CAS 93753-33-4) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)benzaldehyde. InChIKey: KDWYPRNOEMXUNA-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)benzaldehyde |
| InChIKey | KDWYPRNOEMXUNA-UHFFFAOYSA-N |
| SMILES | C=CCC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)C=O)O |
Computed by PubChem (NCBI)