CAS 937598-57-7 appears in our catalog under these names: 3-Fluoro-4-(2,2,2-trifluoroethoxy)aniline, 95%, 3-fluoro-4-(2,2,2-trifluoroethoxy)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
3-fluoro-4-(2,2,2-trifluoroethoxy)aniline (CAS 937598-57-7) is a chemical compound with the molecular formula C8H7F4NO and a molecular weight of 209.14 g/mol. IUPAC name: 3-fluoro-4-(2,2,2-trifluoroethoxy)aniline. InChIKey: ZYFCTKCQWPSPHL-UHFFFAOYSA-N.
| Molecular formula | C8H7F4NO |
|---|---|
| Molecular weight | 209.14 g/mol |
| IUPAC name | 3-fluoro-4-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | ZYFCTKCQWPSPHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)F)OCC(F)(F)F |
Computed by PubChem (NCBI)