CAS 937606-00-3 is the registry number for 2-(3-Cyclopropyl-6-methyl-4-(trifluoromethyl)-1H-pyrazolo(3,4-b)pyridin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-cyclopropyl-6-methyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]acetic acid (CAS 937606-00-3) is a chemical compound with the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. IUPAC name: 2-[3-cyclopropyl-6-methyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]acetic acid. InChIKey: PDEKKKQBJUJOQT-UHFFFAOYSA-N.
| Molecular formula | C13H12F3N3O2 |
|---|---|
| Molecular weight | 299.25 g/mol |
| IUPAC name | 2-[3-cyclopropyl-6-methyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]acetic acid |
| InChIKey | PDEKKKQBJUJOQT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=NN(C2=N1)CC(=O)O)C3CC3)C(F)(F)F |
Computed by PubChem (NCBI)