CAS 956571-72-5 is the registry number for Ethyl 5-methyl-1-(5-(trifluoromethyl)pyridin-2-yl)-1H-pyrazole-4-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxylate (CAS 956571-72-5) is a chemical compound with the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. IUPAC name: ethyl 5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxylate. InChIKey: GGYXXNUZAKJRMP-UHFFFAOYSA-N.
| Molecular formula | C13H12F3N3O2 |
|---|---|
| Molecular weight | 299.25 g/mol |
| IUPAC name | ethyl 5-methyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazole-4-carboxylate |
| InChIKey | GGYXXNUZAKJRMP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=NC=C(C=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)