CAS 926194-97-0 is the registry number for 2-{3,5-dimethyl-1-(5-(trifluoromethyl)pyridin-2-yl)-1H-pyrazol-4-yl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[3,5-dimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]acetic acid (CAS 926194-97-0) is a chemical compound with the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. IUPAC name: 2-[3,5-dimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]acetic acid. InChIKey: GPQOAFUQAGXDHY-UHFFFAOYSA-N.
| Molecular formula | C13H12F3N3O2 |
|---|---|
| Molecular weight | 299.25 g/mol |
| IUPAC name | 2-[3,5-dimethyl-1-[5-(trifluoromethyl)-2-pyridinyl]pyrazol-4-yl]acetic acid |
| InChIKey | GPQOAFUQAGXDHY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=NC=C(C=C2)C(F)(F)F)C)CC(=O)O |
Computed by PubChem (NCBI)