CAS 937621-15-3 is the registry number for 4-((2-Fluorophenyl)sulfamoyl)-1H-pyrrole-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[(2-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (CAS 937621-15-3) is a chemical compound with the molecular formula C11H9FN2O4S and a molecular weight of 284.27 g/mol. IUPAC name: 4-[(2-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid. InChIKey: BFEAVAWQXNXRRO-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O4S |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 4-[(2-fluorophenyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| InChIKey | BFEAVAWQXNXRRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NS(=O)(=O)C2=CNC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)