CAS 937635-08-0 appears in our catalog under these names: 2-Benzoyl-4,5-difluorobenzoic acid, 95%, 2-Benzoyl-4,5-difluorobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-benzoyl-4,5-difluorobenzoic acid (CAS 937635-08-0) is a chemical compound with the molecular formula C14H8F2O3 and a molecular weight of 262.21 g/mol. IUPAC name: 2-benzoyl-4,5-difluorobenzoic acid. InChIKey: PVWSTKQYLMKFCC-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O3 |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | 2-benzoyl-4,5-difluorobenzoic acid |
| InChIKey | PVWSTKQYLMKFCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2C(=O)O)F)F |
Computed by PubChem (NCBI)