CAS 938006-47-4 is the registry number for Methyl 6-cyclopropyl-1,3-dimethyl-1H-pyrazolo(3,4-b)pyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Methyl 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate (CAS 938006-47-4) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: methyl 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate. InChIKey: FCUIHWDVRYNNPP-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | methyl 6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxylate |
| InChIKey | FCUIHWDVRYNNPP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC(=N2)C3CC3)C(=O)OC)C |
Computed by PubChem (NCBI)