CAS 938320-00-4 is the registry number for 3-(3,5-Dimethyl-phenoxy)-2,2-dimethyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3,5-dimethylphenoxy)-2,2-dimethylpropanoic acid (CAS 938320-00-4) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3-(3,5-dimethylphenoxy)-2,2-dimethylpropanoic acid. InChIKey: BNELRYFPTXWOBT-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 3-(3,5-dimethylphenoxy)-2,2-dimethylpropanoic acid |
| InChIKey | BNELRYFPTXWOBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OCC(C)(C)C(=O)O)C |
Computed by PubChem (NCBI)