Products 938320-00-4

CAS 938320-00-4 is the registry number for 3-(3,5-Dimethyl-phenoxy)-2,2-dimethyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(3,5-dimethylphenoxy)-2,2-dimethylpropanoic acid (CAS 938320-00-4) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 3-(3,5-dimethylphenoxy)-2,2-dimethylpropanoic acid. InChIKey: BNELRYFPTXWOBT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC name3-(3,5-dimethylphenoxy)-2,2-dimethylpropanoic acid
InChIKeyBNELRYFPTXWOBT-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)OCC(C)(C)C(=O)O)C

Computed by PubChem (NCBI)